Basic Molecules¶
This example category is for simple molecules that make the main Surfacia ideas easy to inspect.
Good Starting Systems¶
small neutral organics
single functional-group substitutions
simple aromatic molecules
Suggested Mini Set¶
A useful first example set is:
caffeine
aspirin
ibuprofen
These are helpful because they already differ in:
size and shape
heteroatom content
polarity distribution
functional-group composition
Example Input Table¶
Sample Name,SMILES
caffeine,CN1C=NC2=C1C(=O)N(C(=O)N2C)C
aspirin,CC(=O)OC1=CC=CC=C1C(=O)O
ibuprofen,CC(C)CC1=CC=C(C=C1)C(C)C(=O)O
Suggested Command Sequence¶
surfacia workflow -i molecules.csv --resume --test-samples "1,2"
Then inspect the main outputs:
complete descriptor table
compact model outputs
SHAP results
What to Compare First¶
For a small three-molecule set, start with descriptors that are easy to reason about:
Molecule WeightIsosurface AreaESP_minandESP_maxALIE_minselected
Fun_*descriptors
What These Examples Are Good For¶
verifying that the workflow runs correctly
learning how descriptor names map to chemistry
checking how size, shape, and surface electronics change across simple structures
What You Can Usually Observe¶
With a small molecule set like this, you can often inspect:
how
Molecule WeightandIsosurface Areachange with scaffold sizehow
ESPandALIEextrema shift with carbonyls, acids, or heterocycleshow
Fun_*descriptors summarize chemically distinct groups
How to Read the Results¶
Ask a few simple questions:
which molecule is the largest and most surface-exposed?
which molecule has the strongest polar or electron-rich region?
do the retained compact features match the chemistry you would expect from the structures?
can you explain the differences without reading every descriptor column?
If the answer to the last question is yes, then Surfacia's descriptor language is already starting to work for you.
Simple Interpretation Template¶
When writing up your own notes, a short template like this usually works well:
Size and shape Which molecule appears larger, more compact, or more anisotropic?
Surface electronics Which molecule shows the strongest electron-rich or electron-poor region?
Functional grouping Do the
Fun_*descriptors separate the molecules in a chemically intuitive way?Compact model If only a few descriptors survive, do they match what you would have expected from the structures?
What Counts as a Healthy Output¶
For a small sanity-check example, a healthy result usually means:
the workflow finishes cleanly
descriptor values differ across molecules in plausible ways
extreme values such as
ESP_minorALIE_minare not obviously nonsensicalthe retained features are easier to explain than the full feature table
Why This Example Matters¶
Basic molecules are not only for testing installation. They are often the fastest way to understand whether Surfacia's descriptor language is intuitive to you before moving on to larger systems.